CAS 2940935-31-7 appears in our catalog under these names: 3-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)oxy)propanoic acid, 98%, 3-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)oxy)propanoic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 100mg, 250mg, 500mg, 1g.
3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypropanoic acid (CAS 2940935-31-7) is a chemical compound with the molecular formula C16H14N2O7 and a molecular weight of 346.29 g/mol. IUPAC name: 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypropanoic acid. InChIKey: YOIBRGLCSCVBBO-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O7 |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypropanoic acid |
| InChIKey | YOIBRGLCSCVBBO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)OCCC(=O)O |
Computed by PubChem (NCBI)