CAS 23701-87-3 is the registry number for Methyl 6-azido-6-deoxy-a-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(2R,3S,4S,5R,6S)-2-(azidomethyl)-6-methoxyoxane-3,4,5-triol (CAS 23701-87-3) is a chemical compound with the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(azidomethyl)-6-methoxyoxane-3,4,5-triol. InChIKey: DITZTAYZVSZBCC-ZFYZTMLRSA-N.
| Molecular formula | C7H13N3O5 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(azidomethyl)-6-methoxyoxane-3,4,5-triol |
| InChIKey | DITZTAYZVSZBCC-ZFYZTMLRSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CN=[N+]=[N-])O)O)O |
Computed by PubChem (NCBI)