CAS 55965-97-4 is the registry number for Creatine pyruvate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g, 500g.
2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoic acid (CAS 55965-97-4) is a chemical compound with the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. IUPAC name: 2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoic acid. InChIKey: DLNGCCQFGNSBOP-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O5 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoic acid |
| InChIKey | DLNGCCQFGNSBOP-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)O.CN(CC(=O)O)C(=N)N |
Computed by PubChem (NCBI)