Products 55965-97-4

CAS 55965-97-4 is the registry number for Creatine pyruvate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g, 500g.

Structural formula: {0} (CAS {1})

2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoic acid (CAS 55965-97-4) is a chemical compound with the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. IUPAC name: 2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoic acid. InChIKey: DLNGCCQFGNSBOP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13N3O5
Molecular weight219.20 g/mol
IUPAC name2-[carbamimidoyl(methyl)amino]acetic acid;2-oxopropanoic acid
InChIKeyDLNGCCQFGNSBOP-UHFFFAOYSA-N
SMILESCC(=O)C(=O)O.CN(CC(=O)O)C(=N)N

Computed by PubChem (NCBI)