CAS 87376-50-9 is the registry number for Methyl 2-Azido-2-deoxy-beta-D-galactopyranoside. Offered by: TRC. Available pack sizes: 1g.
(2R,3R,4R,5R,6R)-5-azido-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (CAS 87376-50-9) is a chemical compound with the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. IUPAC name: (2R,3R,4R,5R,6R)-5-azido-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol. InChIKey: QYZPIZZUWJKSTF-XUUWZHRGSA-N.
| Molecular formula | C7H13N3O5 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | (2R,3R,4R,5R,6R)-5-azido-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| InChIKey | QYZPIZZUWJKSTF-XUUWZHRGSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)