CAS 23705-85-3 appears in our catalog under these names: 1H-Pyrazole-3,5-dicarboxylic acid, 4-hydroxy-, dimethyl ester, 95%, Dimethyl 4-Hydroxy-1H-pyrazole-3,5-dicarboxylate, >95% (HPLC), KDM4-IN-I, 95%, Dimethyl 4-Hydroxypyrazole-3,5-dicarboxylate, 95%, 95%, DIMETHYL 4-HYDROXYPYRAZOLE-3,5-DICARBOXYLATE, 95%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25g, 5g, 10g, 100mg, 500mg, 50mg.
Dimethyl 4-hydroxy-1H-pyrazole-3,5-dicarboxylate (CAS 23705-85-3) is a chemical compound with the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. IUPAC name: dimethyl 4-hydroxy-1H-pyrazole-3,5-dicarboxylate. InChIKey: FBZGCRCSPADZHL-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O5 |
|---|---|
| Molecular weight | 200.15 g/mol |
| IUPAC name | dimethyl 4-hydroxy-1H-pyrazole-3,5-dicarboxylate |
| InChIKey | FBZGCRCSPADZHL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NN1)C(=O)OC)O |
Computed by PubChem (NCBI)