Products 923942-39-6

CAS 923942-39-6 is the registry number for Methyl 2,6-dihydroxy-5-methoxypyrimidine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 5-methoxy-2,4-dioxo-1H-pyrimidine-6-carboxylate (CAS 923942-39-6) is a chemical compound with the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. IUPAC name: methyl 5-methoxy-2,4-dioxo-1H-pyrimidine-6-carboxylate. InChIKey: DDJYTNJDKMWYBN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O5
Molecular weight200.15 g/mol
IUPAC namemethyl 5-methoxy-2,4-dioxo-1H-pyrimidine-6-carboxylate
InChIKeyDDJYTNJDKMWYBN-UHFFFAOYSA-N
SMILESCOC1=C(NC(=O)NC1=O)C(=O)OC

Computed by PubChem (NCBI)