Products 2588445-17-2

CAS 2588445-17-2 is the registry number for 5-Methoxy-1-methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methoxy-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 2588445-17-2) is a chemical compound with the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. IUPAC name: 5-methoxy-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: SNXRZUWIMXIABF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O5
Molecular weight200.15 g/mol
IUPAC name5-methoxy-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylic acid
InChIKeySNXRZUWIMXIABF-UHFFFAOYSA-N
SMILESCN1C(=O)C(=C(NC1=O)C(=O)O)OC

Computed by PubChem (NCBI)