CAS 2588445-17-2 is the registry number for 5-Methoxy-1-methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 2588445-17-2) is a chemical compound with the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. IUPAC name: 5-methoxy-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: SNXRZUWIMXIABF-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O5 |
|---|---|
| Molecular weight | 200.15 g/mol |
| IUPAC name | 5-methoxy-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | SNXRZUWIMXIABF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(NC1=O)C(=O)O)OC |
Computed by PubChem (NCBI)