Products 23720-80-1
CAS 23720-80-1 appears in our catalog under these names: Nardosinone, >95% (HPLC), Nardosinone, Nardosinone/ 98%, (3aR,9R,9aR,9bS)-1,1,9,9a-Tetramethyl-3a,4,7,8,9,9a-hexahydro-1H-naphtho[2,1-c][1,2]dioxol-5(9bH)-one, 99%, 99%, Nardosinone (Standard). Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 1g, 500mg, 50mg, 10mg, 100mg, 20mg, 5mg, 10mM (in 1ml dmso).
(3aR,9R,9aR,9bS)-1,1,9,9a-tetramethyl-3a,4,7,8,9,9b-hexahydronaphtho[2,1-c]dioxol-5-one (CAS 23720-80-1) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: (3aR,9R,9aR,9bS)-1,1,9,9a-tetramethyl-3a,4,7,8,9,9b-hexahydronaphtho[2,1-c]dioxol-5-one. InChIKey: KXGHHSIMRWPVQM-JWFUOXDNSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | (3aR,9R,9aR,9bS)-1,1,9,9a-tetramethyl-3a,4,7,8,9,9b-hexahydronaphtho[2,1-c]dioxol-5-one |
| InChIKey | KXGHHSIMRWPVQM-JWFUOXDNSA-N |
| SMILES | C[C@@H]1CCC=C2[C@]1([C@H]3[C@@H](CC2=O)OOC3(C)C)C |
Computed by PubChem (NCBI)