CAS 2374162-36-2 is the registry number for ITA-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]but-3-enoate (CAS 2374162-36-2) is a chemical compound with the molecular formula C16H19NO5 and a molecular weight of 305.32 g/mol. IUPAC name: methyl 3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]but-3-enoate. InChIKey: PWAIEBHHXMJUQG-ZDUSSCGKSA-N.
| Molecular formula | C16H19NO5 |
|---|---|
| Molecular weight | 305.32 g/mol |
| IUPAC name | methyl 3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]but-3-enoate |
| InChIKey | PWAIEBHHXMJUQG-ZDUSSCGKSA-N |
| SMILES | COC(=O)CC(=C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)