Products 2374705-47-0
CAS 2374705-47-0 is the registry number for tert-Butyl 8,10-dioxo-3-azaspiro(5.5)undecane-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxylate (CAS 2374705-47-0) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: tert-butyl 8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxylate. InChIKey: UNGFTBZOLJAYQP-UHFFFAOYSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | tert-butyl 8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxylate |
| InChIKey | UNGFTBZOLJAYQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)