CAS 2375259-29-1 is the registry number for tert-Butyl 3-{((tert-butoxy)carbonyl)(hydroxy)amino}azetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]azetidine-1-carboxylate (CAS 2375259-29-1) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: tert-butyl 3-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]azetidine-1-carboxylate. InChIKey: LTVONVZUAFZLBW-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | tert-butyl 3-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]azetidine-1-carboxylate |
| InChIKey | LTVONVZUAFZLBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)N(C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)