Products 2375259-96-2
CAS 2375259-96-2 is the registry number for 1H,2H,3H-Pyrrolo(2,3-b)pyridine-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid;hydrochloride (CAS 2375259-96-2) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid;hydrochloride. InChIKey: LXWJGCRYFRNICE-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid;hydrochloride |
| InChIKey | LXWJGCRYFRNICE-UHFFFAOYSA-N |
| SMILES | C1CNC2=NC=CC(=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)