Products 2375260-73-2
CAS 2375260-73-2 is the registry number for Methyl 2-amino-5-{((tert-butoxy)carbonyl)(methyl)amino}benzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-amino-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoate (CAS 2375260-73-2) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: methyl 2-amino-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoate. InChIKey: CRHXJMNDEYVLHH-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | methyl 2-amino-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoate |
| InChIKey | CRHXJMNDEYVLHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)