CAS 2375270-77-0 is the registry number for 5-Benzyl-1,2-oxazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-benzyl-1,2-oxazol-4-amine;hydrochloride (CAS 2375270-77-0) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 5-benzyl-1,2-oxazol-4-amine;hydrochloride. InChIKey: LJJCCBOTVZERHS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 5-benzyl-1,2-oxazol-4-amine;hydrochloride |
| InChIKey | LJJCCBOTVZERHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C=NO2)N.Cl |
Computed by PubChem (NCBI)