CAS 2375924-14-2 is the registry number for rel-1-(((1R,2R)-2-Fluorocyclopropyl)sulfonyl)-4-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(1R,2R)-2-fluorocyclopropyl]sulfonyl-4-nitrobenzene (CAS 2375924-14-2) is a chemical compound with the molecular formula C9H8FNO4S and a molecular weight of 245.23 g/mol. IUPAC name: 1-[(1R,2R)-2-fluorocyclopropyl]sulfonyl-4-nitrobenzene. InChIKey: NTPLHIJVHLZERG-RKDXNWHRSA-N.
| Molecular formula | C9H8FNO4S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 1-[(1R,2R)-2-fluorocyclopropyl]sulfonyl-4-nitrobenzene |
| InChIKey | NTPLHIJVHLZERG-RKDXNWHRSA-N |
| SMILES | C1[C@H]([C@@H]1S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)