CAS 877964-10-8 is the registry number for 2-(2-Oxo-2,3-dihydro-1,3-benzoxazol-3-yl)ethane-1-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-oxo-1,3-benzoxazol-3-yl)ethanesulfonyl fluoride (CAS 877964-10-8) is a chemical compound with the molecular formula C9H8FNO4S and a molecular weight of 245.23 g/mol. IUPAC name: 2-(2-oxo-1,3-benzoxazol-3-yl)ethanesulfonyl fluoride. InChIKey: HNFBNDGFOXBCDQ-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 2-(2-oxo-1,3-benzoxazol-3-yl)ethanesulfonyl fluoride |
| InChIKey | HNFBNDGFOXBCDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)O2)CCS(=O)(=O)F |
Computed by PubChem (NCBI)