CAS 906820-09-5 appears in our catalog under these names: 4-Fluoroisoquinoline sulfurate, 95%, 4-Fluoroisoquinoline sulfate, 97%, 4-Fluoroisoquinoline sulfate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-fluoroisoquinoline;sulfuric acid (CAS 906820-09-5) is a chemical compound with the molecular formula C9H8FNO4S and a molecular weight of 245.23 g/mol. IUPAC name: 4-fluoroisoquinoline;sulfuric acid. InChIKey: UIWPLWVBONXKIT-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 4-fluoroisoquinoline;sulfuric acid |
| InChIKey | UIWPLWVBONXKIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC=C2F.OS(=O)(=O)O |
Computed by PubChem (NCBI)