Products 2376054-07-6
CAS 2376054-07-6 appears in our catalog under these names: 4，4'-((4-(4H-1，2，4-Triazol-4-yl)phenyl)azanediyl)dibenzoic acid, 98%, 98%, 4,4'-((4-(4H-1,2,4-Triazol-4-yl)phenyl)azanediyl)dibenzoic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-carboxy-N-[4-(1,2,4-triazol-4-yl)phenyl]anilino)benzoic acid (CAS 2376054-07-6) is a chemical compound with the molecular formula C22H16N4O4 and a molecular weight of 400.4 g/mol. IUPAC name: 4-(4-carboxy-N-[4-(1,2,4-triazol-4-yl)phenyl]anilino)benzoic acid. InChIKey: IWLLKVQJZYERNI-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O4 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 4-(4-carboxy-N-[4-(1,2,4-triazol-4-yl)phenyl]anilino)benzoic acid |
| InChIKey | IWLLKVQJZYERNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N(C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)N4C=NN=C4 |
Computed by PubChem (NCBI)