Products 2376439-38-0
CAS 2376439-38-0 is the registry number for Benzoic acid, 4-(2-fluoro-4-pyridinyl)-, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-fluoro-4-pyridinyl)benzoic acid (CAS 2376439-38-0) is a chemical compound with the molecular formula C12H8FNO2 and a molecular weight of 217.20 g/mol. IUPAC name: 4-(2-fluoro-4-pyridinyl)benzoic acid. InChIKey: UDAJENBZENVORA-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO2 |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | 4-(2-fluoro-4-pyridinyl)benzoic acid |
| InChIKey | UDAJENBZENVORA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=C2)F)C(=O)O |
Computed by PubChem (NCBI)