Products 2377004-44-7
CAS 2377004-44-7 is the registry number for (3R,5R)-5-(Aminomethyl)pyrrolidin-3-ol dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R,5R)-5-(aminomethyl)pyrrolidin-3-ol;dihydrochloride (CAS 2377004-44-7) is a chemical compound with the molecular formula C5H14Cl2N2O and a molecular weight of 189.08 g/mol. IUPAC name: (3R,5R)-5-(aminomethyl)pyrrolidin-3-ol;dihydrochloride. InChIKey: IWERJYZLTFXUAX-ALUAXPQUSA-N.
| Molecular formula | C5H14Cl2N2O |
|---|---|
| Molecular weight | 189.08 g/mol |
| IUPAC name | (3R,5R)-5-(aminomethyl)pyrrolidin-3-ol;dihydrochloride |
| InChIKey | IWERJYZLTFXUAX-ALUAXPQUSA-N |
| SMILES | C1[C@H](CN[C@H]1CN)O.Cl.Cl |
Computed by PubChem (NCBI)