Products 2377005-28-0
CAS 2377005-28-0 is the registry number for Rac-(1r,3s)-3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Trans-(1S,3R)-3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid (CAS 2377005-28-0) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: trans-(1S,3R)-3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid. InChIKey: RCADQIRMKGJSHI-QPUJVOFHSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | trans-(1S,3R)-3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| InChIKey | RCADQIRMKGJSHI-QPUJVOFHSA-N |
| SMILES | C[C@@]1(CC[C@H](C1(C)C)C(=O)N(C)C)C(=O)O |
Computed by PubChem (NCBI)