Products 91691-00-8
CAS 91691-00-8 is the registry number for 3-[(Dimethylamino)carbonyl]-1,2,2-trimethylcyclopentanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid (CAS 91691-00-8) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: 3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid. InChIKey: RCADQIRMKGJSHI-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | 3-(dimethylcarbamoyl)-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| InChIKey | RCADQIRMKGJSHI-UHFFFAOYSA-N |
| SMILES | CC1(C(CCC1(C)C(=O)O)C(=O)N(C)C)C |
Computed by PubChem (NCBI)