Products 2377028-36-7

CAS 2377028-36-7 is the registry number for 2-Amino-3-methoxybenzoic Acid-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.

Structural formula: {0} (CAS {1})

2-amino-3-(trideuteriomethoxy)benzoic acid (CAS 2377028-36-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 170.18 g/mol. IUPAC name: 2-amino-3-(trideuteriomethoxy)benzoic acid. InChIKey: SXOPCLUOUFQBJV-FIBGUPNXSA-N.

Identity
Molecular formulaC8H9NO3
Molecular weight170.18 g/mol
IUPAC name2-amino-3-(trideuteriomethoxy)benzoic acid
InChIKeySXOPCLUOUFQBJV-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])OC1=CC=CC(=C1N)C(=O)O

Computed by PubChem (NCBI)