CAS 2377028-36-7 is the registry number for 2-Amino-3-methoxybenzoic Acid-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
2-amino-3-(trideuteriomethoxy)benzoic acid (CAS 2377028-36-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 170.18 g/mol. IUPAC name: 2-amino-3-(trideuteriomethoxy)benzoic acid. InChIKey: SXOPCLUOUFQBJV-FIBGUPNXSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 170.18 g/mol |
| IUPAC name | 2-amino-3-(trideuteriomethoxy)benzoic acid |
| InChIKey | SXOPCLUOUFQBJV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1N)C(=O)O |
Computed by PubChem (NCBI)