CAS 2377033-09-3 is the registry number for 6-((tert-Butoxy)carbonyl)-6-azaspiro(2.5)octane-1,1-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-2,2-dicarboxylic acid (CAS 2377033-09-3) is a chemical compound with the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-2,2-dicarboxylic acid. InChIKey: QBSKWOGPGSAXRS-UHFFFAOYSA-N.
| Molecular formula | C14H21NO6 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-2,2-dicarboxylic acid |
| InChIKey | QBSKWOGPGSAXRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC2(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)