Products 476168-17-9

CAS 476168-17-9 is the registry number for Erlotinib Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate (CAS 476168-17-9) is a chemical compound with the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. IUPAC name: methyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate. InChIKey: CUPLOYMSPMXGQF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO6
Molecular weight299.32 g/mol
IUPAC namemethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate
InChIKeyCUPLOYMSPMXGQF-UHFFFAOYSA-N
SMILESCOCCOC1=C(C=C(C(=C1)C(=O)OC)N)OCCOC

Computed by PubChem (NCBI)