Products 2377036-12-7
CAS 2377036-12-7 is the registry number for Methyl 3-(1-aminocyclopropyl)-5-fluorobenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3-(1-aminocyclopropyl)-5-fluorobenzoate;hydrochloride (CAS 2377036-12-7) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: methyl 3-(1-aminocyclopropyl)-5-fluorobenzoate;hydrochloride. InChIKey: NHDAEIWRPXNEHO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | methyl 3-(1-aminocyclopropyl)-5-fluorobenzoate;hydrochloride |
| InChIKey | NHDAEIWRPXNEHO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)F)C2(CC2)N.Cl |
Computed by PubChem (NCBI)