CAS 23772-38-5 appears in our catalog under these names: 5–Methoxy–6–nitroindoline, 5-Methoxy-6-nitroindoline 95%, 5-Methoxy-6-nitroindoline, 95%, 95%, 5-Methoxy-6-nitro-2,3-dihydro-1h-indole, 95%. Offered by: GLPBio, Ambeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
5-methoxy-6-nitro-2,3-dihydro-1H-indole (CAS 23772-38-5) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 5-methoxy-6-nitro-2,3-dihydro-1H-indole. InChIKey: XTJWZASEAYSGRT-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 5-methoxy-6-nitro-2,3-dihydro-1H-indole |
| InChIKey | XTJWZASEAYSGRT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)