Products 2377407-37-7
CAS 2377407-37-7 is the registry number for 5-(1H-Indol-6-yl)-1H-pyrazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1H-indol-6-yl)-1H-pyrazol-3-amine (CAS 2377407-37-7) is a chemical compound with the molecular formula C11H10N4 and a molecular weight of 198.22 g/mol. IUPAC name: 5-(1H-indol-6-yl)-1H-pyrazol-3-amine. InChIKey: WGNBSWSUVHVDSW-UHFFFAOYSA-N.
| Molecular formula | C11H10N4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 5-(1H-indol-6-yl)-1H-pyrazol-3-amine |
| InChIKey | WGNBSWSUVHVDSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2)C3=CC(=NN3)N |
Computed by PubChem (NCBI)