Products 2377607-77-5
CAS 2377607-77-5 is the registry number for 4-(5-Benzyl-1,2,4-oxadiazol-3-yl)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid (CAS 2377607-77-5) is a chemical compound with the molecular formula C15H13BN2O3 and a molecular weight of 280.09 g/mol. IUPAC name: [4-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid. InChIKey: DALQPWLDIBISTH-UHFFFAOYSA-N.
| Molecular formula | C15H13BN2O3 |
|---|---|
| Molecular weight | 280.09 g/mol |
| IUPAC name | [4-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| InChIKey | DALQPWLDIBISTH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NOC(=N2)CC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)