Products 2377609-83-9
CAS 2377609-83-9 is the registry number for 2-(5-Benzyl-1,2,4-oxadiazol-3-yl)phenylboronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[2-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid (CAS 2377609-83-9) is a chemical compound with the molecular formula C15H13BN2O3 and a molecular weight of 280.09 g/mol. IUPAC name: [2-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid. InChIKey: KVKQHTAQTGRFNR-UHFFFAOYSA-N.
| Molecular formula | C15H13BN2O3 |
|---|---|
| Molecular weight | 280.09 g/mol |
| IUPAC name | [2-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| InChIKey | KVKQHTAQTGRFNR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=NOC(=N2)CC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)