Products 2377609-92-0
CAS 2377609-92-0 appears in our catalog under these names: {4-[5-(4-Methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl}boronic acid, 95%, {4-(5-(4-Methylphenyl)-1,2,4-oxadiazol-3-yl)phenyl}boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid (CAS 2377609-92-0) is a chemical compound with the molecular formula C15H13BN2O3 and a molecular weight of 280.09 g/mol. IUPAC name: [4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid. InChIKey: ZNHJXWQRCHMCKJ-UHFFFAOYSA-N.
| Molecular formula | C15H13BN2O3 |
|---|---|
| Molecular weight | 280.09 g/mol |
| IUPAC name | [4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid |
| InChIKey | ZNHJXWQRCHMCKJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NOC(=N2)C3=CC=C(C=C3)C)(O)O |
Computed by PubChem (NCBI)