CAS 2377607-82-2 appears in our catalog under these names: 4-(Benzyloxy)-5-bromo-2-fluorophenylboronic acid, 95%, (4-(Benzyloxy)-5-bromo-2-fluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g.
(5-bromo-2-fluoro-4-phenylmethoxyphenyl)boronic acid (CAS 2377607-82-2) is a chemical compound with the molecular formula C13H11BBrFO3 and a molecular weight of 324.94 g/mol. IUPAC name: (5-bromo-2-fluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: MABIXXCWUOZODK-UHFFFAOYSA-N.
| Molecular formula | C13H11BBrFO3 |
|---|---|
| Molecular weight | 324.94 g/mol |
| IUPAC name | (5-bromo-2-fluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | MABIXXCWUOZODK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OCC2=CC=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)