CAS 849052-22-8 appears in our catalog under these names: 3-Bromo-2-(4'-fluorobenzyloxy)phenylboronic acid, 95%, 3–Bromo–2–(4′–fluorobenzyloxy)phenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
[3-bromo-2-[(4-fluorophenyl)methoxy]phenyl]boronic acid (CAS 849052-22-8) is a chemical compound with the molecular formula C13H11BBrFO3 and a molecular weight of 324.94 g/mol. IUPAC name: [3-bromo-2-[(4-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: FAGFWOJETYFVAS-UHFFFAOYSA-N.
| Molecular formula | C13H11BBrFO3 |
|---|---|
| Molecular weight | 324.94 g/mol |
| IUPAC name | [3-bromo-2-[(4-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | FAGFWOJETYFVAS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)OCC2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)