CAS 870778-86-2 is the registry number for 3-Bromo-2-(2'-fluorobenzyloxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[3-bromo-2-[(2-fluorophenyl)methoxy]phenyl]boronic acid (CAS 870778-86-2) is a chemical compound with the molecular formula C13H11BBrFO3 and a molecular weight of 324.94 g/mol. IUPAC name: [3-bromo-2-[(2-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: XTBIXNSHJQLMFR-UHFFFAOYSA-N.
| Molecular formula | C13H11BBrFO3 |
|---|---|
| Molecular weight | 324.94 g/mol |
| IUPAC name | [3-bromo-2-[(2-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | XTBIXNSHJQLMFR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)OCC2=CC=CC=C2F)(O)O |
Computed by PubChem (NCBI)