CAS 2377607-96-8 appears in our catalog under these names: 3-(Hydroxymethyl)-5-methylphenylboronic acid pinacol ester, 96%, 3-(Hydroxymethyl)-5-methylphenylboronic acid pinacol ester, 3-(Hydroxymethyl)-5-methylphenylboronic Acid Pinacol Ester, 98%, 98%, (3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 25g.
[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 2377607-96-8) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: [3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: DHMSQZHEQIAFGF-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | [3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | DHMSQZHEQIAFGF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)CO)C |
Computed by PubChem (NCBI)