CAS 2377609-29-3 appears in our catalog under these names: 5-(Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid, 96%, 5-(TEtramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid (CAS 2377609-29-3) is a chemical compound with the molecular formula C15H17BO5 and a molecular weight of 288.11 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid. InChIKey: WZUWYDZOGUCKJI-UHFFFAOYSA-N.
| Molecular formula | C15H17BO5 |
|---|---|
| Molecular weight | 288.11 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid |
| InChIKey | WZUWYDZOGUCKJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC(=C3)C(=O)O |
Computed by PubChem (NCBI)