CAS 482627-95-2 is the registry number for [4-(Benzyloxy)-3,5-dimethoxyphenyl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3,5-dimethoxy-4-phenylmethoxyphenyl)boronic acid (CAS 482627-95-2) is a chemical compound with the molecular formula C15H17BO5 and a molecular weight of 288.11 g/mol. IUPAC name: (3,5-dimethoxy-4-phenylmethoxyphenyl)boronic acid. InChIKey: YWLNSHVDTNNYKX-UHFFFAOYSA-N.
| Molecular formula | C15H17BO5 |
|---|---|
| Molecular weight | 288.11 g/mol |
| IUPAC name | (3,5-dimethoxy-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | YWLNSHVDTNNYKX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)OCC2=CC=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)