CAS 870718-08-4 is the registry number for (4-((3,5-Dimethoxybenzyl)oxy)phenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid (CAS 870718-08-4) is a chemical compound with the molecular formula C15H17BO5 and a molecular weight of 288.11 g/mol. IUPAC name: [4-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid. InChIKey: VGULDMBLXOLKDX-UHFFFAOYSA-N.
| Molecular formula | C15H17BO5 |
|---|---|
| Molecular weight | 288.11 g/mol |
| IUPAC name | [4-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid |
| InChIKey | VGULDMBLXOLKDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC(=CC(=C2)OC)OC)(O)O |
Computed by PubChem (NCBI)