Products 2378125-27-8
CAS 2378125-27-8 is the registry number for 4-[(1E)-2-(1-Methyl-1H-pyrazol-4-yl)diazenyl]phenol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[(1-methylpyrazol-4-yl)diazenyl]phenol (CAS 2378125-27-8) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: 4-[(1-methylpyrazol-4-yl)diazenyl]phenol. InChIKey: STCVJLLQFVOXTO-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4-[(1-methylpyrazol-4-yl)diazenyl]phenol |
| InChIKey | STCVJLLQFVOXTO-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)N=NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)