Products 2378180-01-7
CAS 2378180-01-7 is the registry number for 2'-Amino-5'-cyano-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-amino-3-(4-carboxyphenyl)-5-cyanophenyl]benzoic acid (CAS 2378180-01-7) is a chemical compound with the molecular formula C21H14N2O4 and a molecular weight of 358.3 g/mol. IUPAC name: 4-[2-amino-3-(4-carboxyphenyl)-5-cyanophenyl]benzoic acid. InChIKey: GLWKJSMSPGFSSM-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O4 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 4-[2-amino-3-(4-carboxyphenyl)-5-cyanophenyl]benzoic acid |
| InChIKey | GLWKJSMSPGFSSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2N)C3=CC=C(C=C3)C(=O)O)C#N)C(=O)O |
Computed by PubChem (NCBI)