Products 1309925-41-4
CAS 1309925-41-4 is the registry number for Tubulin inhibitor 7. Offered by: MedChemExpress. Available pack sizes: Get quote.
10-(3-hydroxy-4-methoxybenzoyl)phenoxazine-3-carbonitrile (CAS 1309925-41-4) is a chemical compound with the molecular formula C21H14N2O4 and a molecular weight of 358.3 g/mol. IUPAC name: 10-(3-hydroxy-4-methoxybenzoyl)phenoxazine-3-carbonitrile. InChIKey: IQBCGEKPMZGLBD-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O4 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 10-(3-hydroxy-4-methoxybenzoyl)phenoxazine-3-carbonitrile |
| InChIKey | IQBCGEKPMZGLBD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)N2C3=C(C=C(C=C3)C#N)OC4=CC=CC=C42)O |
Computed by PubChem (NCBI)