CAS 2568146-49-4 is the registry number for 4,4'-(1H-Benzo[d]imidazole-4,7-diyl)dibenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[7-(4-carboxyphenyl)-3H-benzimidazol-4-yl]benzoic acid (CAS 2568146-49-4) is a chemical compound with the molecular formula C21H14N2O4 and a molecular weight of 358.3 g/mol. IUPAC name: 4-[7-(4-carboxyphenyl)-3H-benzimidazol-4-yl]benzoic acid. InChIKey: JHLVVQWHJMUZSW-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O4 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 4-[7-(4-carboxyphenyl)-3H-benzimidazol-4-yl]benzoic acid |
| InChIKey | JHLVVQWHJMUZSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C(=C(C=C2)C4=CC=C(C=C4)C(=O)O)N=CN3)C(=O)O |
Computed by PubChem (NCBI)