Products 2568146-49-4

CAS 2568146-49-4 is the registry number for 4,4'-(1H-Benzo[d]imidazole-4,7-diyl)dibenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[7-(4-carboxyphenyl)-3H-benzimidazol-4-yl]benzoic acid (CAS 2568146-49-4) is a chemical compound with the molecular formula C21H14N2O4 and a molecular weight of 358.3 g/mol. IUPAC name: 4-[7-(4-carboxyphenyl)-3H-benzimidazol-4-yl]benzoic acid. InChIKey: JHLVVQWHJMUZSW-UHFFFAOYSA-N.

Identity
Molecular formulaC21H14N2O4
Molecular weight358.3 g/mol
IUPAC name4-[7-(4-carboxyphenyl)-3H-benzimidazol-4-yl]benzoic acid
InChIKeyJHLVVQWHJMUZSW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C3C(=C(C=C2)C4=CC=C(C=C4)C(=O)O)N=CN3)C(=O)O

Computed by PubChem (NCBI)