CAS 301676-60-8 is the registry number for 3-(3-(2-Oxo-2H-chromen-3-yl)-1-phenyl-1H-pyrazol-4-yl)prop-2-enoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(E)-3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoic acid (CAS 301676-60-8) is a chemical compound with the molecular formula C21H14N2O4 and a molecular weight of 358.3 g/mol. IUPAC name: (E)-3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoic acid. InChIKey: NVGWKXSWQUQHHS-ZHACJKMWSA-N.
| Molecular formula | C21H14N2O4 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | (E)-3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoic acid |
| InChIKey | NVGWKXSWQUQHHS-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC4=CC=CC=C4OC3=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)