CAS 2378489-89-3 is the registry number for 2-((1S,4S)-4-{((tert-Butoxy)carbonyl)amino}cyclopent-2-en-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(1S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl]acetic acid (CAS 2378489-89-3) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 2-[(1S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl]acetic acid. InChIKey: WZSILGJSQMMXGP-DTWKUNHWSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-[(1S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl]acetic acid |
| InChIKey | WZSILGJSQMMXGP-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](C=C1)CC(=O)O |
Computed by PubChem (NCBI)