Products 2378806-59-6
CAS 2378806-59-6 is the registry number for 2-(4-Amino-2-bromophenoxy)-N,N-dimethylacetamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-amino-2-bromophenoxy)-N,N-dimethylacetamide (CAS 2378806-59-6) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: 2-(4-amino-2-bromophenoxy)-N,N-dimethylacetamide. InChIKey: NHKFYDQQHHEXTF-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 2-(4-amino-2-bromophenoxy)-N,N-dimethylacetamide |
| InChIKey | NHKFYDQQHHEXTF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC1=C(C=C(C=C1)N)Br |
Computed by PubChem (NCBI)