Products 2379241-70-8
CAS 2379241-70-8 is the registry number for Tubulin inhibitor 26. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-methyl-N-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine (CAS 2379241-70-8) is a chemical compound with the molecular formula C17H19N3O3 and a molecular weight of 313.35 g/mol. IUPAC name: 6-methyl-N-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine. InChIKey: WXYDIUWYBVAKRX-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O3 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | 6-methyl-N-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine |
| InChIKey | WXYDIUWYBVAKRX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=NN2)NC3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Tubulin inhibitor 26, orb1689237