Products 2379877-99-1
CAS 2379877-99-1 appears in our catalog under these names: Picosulfate Impurity 15, Picosulfate Impurity 13, Picosulfate Impurity 11, 4,4'-(Hydroxy(pyridin-2-yl)methylene)diphenol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
4-[hydroxy-(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenol (CAS 2379877-99-1) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 4-[hydroxy-(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenol. InChIKey: QDRHBDPHHICLEM-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 4-[hydroxy-(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenol |
| InChIKey | QDRHBDPHHICLEM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)O)(C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)