CAS 2380610-29-5 appears in our catalog under these names: (R)-1,3,7-Triazaspiro(4.4)nonane-2,4-dione, 98%, (5R)-1,3,7-triazaspiro[4.4]nonane-2,4-dione, 97%, 97%, (5R)-1,3,7-TRIAZASPIRO[4.4]NONANE-2,4-DIONE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(5R)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (CAS 2380610-29-5) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: (5R)-1,3,7-triazaspiro[4.4]nonane-2,4-dione. InChIKey: YRYCOOMEQSXVLJ-ZCFIWIBFSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | (5R)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| InChIKey | YRYCOOMEQSXVLJ-ZCFIWIBFSA-N |
| SMILES | C1CNC[C@@]12C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)