CAS 2380813-54-5 is the registry number for 4-(1,1-Dimethylethyl) 2-methyl (2S,6S)-6-(hydroxymethyl)-2,4-morpholinedicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-O-tert-butyl 2-O-methyl (2S,6S)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate (CAS 2380813-54-5) is a chemical compound with the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. IUPAC name: 4-O-tert-butyl 2-O-methyl (2S,6S)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate. InChIKey: QLSZIUDKMLYFGR-IUCAKERBSA-N.
| Molecular formula | C12H21NO6 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-methyl (2S,6S)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate |
| InChIKey | QLSZIUDKMLYFGR-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[C@@H](C1)C(=O)OC)CO |
Computed by PubChem (NCBI)