CAS 1581750-91-5 appears in our catalog under these names: 4-(tert-Butyl) 2-methyl (2S,6R)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate, 95%, 95%, 4-(tert-Butyl) 2-methyl (2S,6R)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-O-tert-butyl 2-O-methyl (2S,6R)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate (CAS 1581750-91-5) is a chemical compound with the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. IUPAC name: 4-O-tert-butyl 2-O-methyl (2S,6R)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate. InChIKey: QLSZIUDKMLYFGR-BDAKNGLRSA-N.
| Molecular formula | C12H21NO6 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-methyl (2S,6R)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate |
| InChIKey | QLSZIUDKMLYFGR-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O[C@@H](C1)C(=O)OC)CO |
Computed by PubChem (NCBI)